CAS 17877-23-5

1,1,1-Tris(1-methylethyl)silanol

Description:

1,1,1-Tris(1-methylethyl)silanol, with the CAS number 17877-23-5, is an organosilicon compound characterized by the presence of a silicon atom bonded to three isopropyl groups and a hydroxyl group. This structure imparts unique properties, including hydrophobicity due to the bulky isopropyl groups, which can hinder the interaction with water molecules. The hydroxyl group contributes to its potential reactivity, allowing for hydrogen bonding and making it useful in various chemical applications. This compound is typically a colorless liquid or solid, depending on the temperature and purity. It is often utilized in the synthesis of silicone polymers and as a surface modifier in various materials, enhancing their hydrophobic characteristics. Additionally, its silanol functionality can participate in condensation reactions, making it valuable in the formulation of adhesives, sealants, and coatings. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₂₂OSi

InChI: InChI=1S/C9H22OSi/c1-7(2)11(10,8(3)4)9(5)6/h7-10H,1-6H3

InChI key: InChIKey=MQNNNLJCDJBERF-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)O

Synonyms:

• tripropan-2-ylsilanol
• Triisopropylsilanol
• Silanol, tris(1-methylethyl)-
• Silanol, 1,1,1-tris(1-methylethyl)-
• 1,1,1-Tris(1-methylethyl)silanol

Silanol, 1,1,1-tris(1-methylethyl)-

CAS: 17877-23-5

Formula: C₉H₂₂OSi

Purity: 98%

Color and Shape: Liquid

Molecular weight: 174.3559

Ref: IN-DA0026BB

Triisopropylsilanol

CAS: 17877-23-5

Triisopropylsilanol

Purity: 98%

Molecular weight: 174.36g/mol

Ref: 54-OR1015334

Triisopropylsilanol

CAS: 17877-23-5

Purity: 98%

Molecular weight: 174.14

Ref: 10-F556656

Triisopropylsilanol

Controlled Product

CAS: 17877-23-5

Formula: C₉H₂₂OSi

Color and Shape: Neat

Molecular weight: 174.356

Ref: TR-T219868