CAS 17879-23-1

Cyclohexanemethanol, 4-(aminomethyl)-, trans-

Description:

Cyclohexanemethanol, 4-(aminomethyl)-, trans- is an organic compound characterized by its cyclohexane ring structure with a hydroxymethyl group and an aminomethyl substituent at the 4-position. This compound features a trans configuration, indicating that the hydroxymethyl and aminomethyl groups are positioned on opposite sides of the cyclohexane ring, which can influence its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of both hydroxyl (-OH) and amino (-NH2) functional groups suggests that it can engage in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the compound may exhibit basic properties due to the amino group, making it potentially reactive in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its applications may extend to pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific uses would depend on further research and development.

Formula: C₈H₁₇NO

InChI: InChI=1S/C8H17NO/c9-5-7-1-3-8(6-10)4-2-7/h7-8,10H,1-6,9H2

InChI key: WWDKVICMJWBJKJ-UHFFFAOYSA-N

SMILES: C1CC(CCC1CN)CO

Trans-4-(Aminomethyl)Cyclohexyl)Methanol

CAS: 17879-23-1

Trans-4-(Aminomethyl)Cyclohexyl)Methanol

Formula: C₈H₁₇NO

Purity: >97%

Molecular weight: 143.23

Ref: 54-OR1028102

trans-4-(Aminomethyl)cyclohexanemethanol

CAS: 17879-23-1

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.2267

Ref: IN-DA0026AZ

trans-4-(Aminomethyl)cyclohexylmethanol

CAS: 17879-23-1

trans-4-(Aminomethyl)cyclohexyl)methanol

Formula: C₈H₁₇NO

Purity: 95%

Molecular weight: 143.23

Ref: IN-DG279261

[trans-4-(aminomethyl)cyclohexyl]methanol

Controlled Product

CAS: 17879-23-1

Formula: C₈H₁₇NO

Color and Shape: Neat

Molecular weight: 143.22

Ref: TR-T312396

[trans-4-(aminomethyl)cyclohexyl]methanol

CAS: 17879-23-1

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.23

Ref: 10-F312681

[4-(Aminomethyl)cyclohexyl]methanol

CAS: 17879-23-1

4-(Aminomethyl)cyclohexyl]methanol is a dicarboxylic acid and ester with the chemical formula CH2=C(CH3)(CO2H). It is used to synthesize polycarbonates, which are polyesters that contain carbonate groups. 4-(Aminomethyl)cyclohexyl]methanol has two carboxyl groups and one hydroxyl group that can react with trimellitic anhydride to form polycarbonates. Polycarbonate is a polymer that contains bisphenol A, which is the building block of many plastics and resins. 4-(Aminomethyl)cyclohexyl]methanol can be used as a monomer in the synthesis of polyesters and copolymers.

Formula: C₈H₁₇NO

Purity: Min. 95%

Color and Shape: Beige Powder

Molecular weight: 143.23 g/mol

Ref: 3D-FA123010