CAS 17880-62-5

(4-METHYL-QUINOLIN-2-YLSULFANYL)-ACETIC ACID

Description:

(4-Methyl-quinolin-2-ylsulfanyl)-acetic acid, with the CAS number 17880-62-5, is a chemical compound characterized by its unique structure that includes a quinoline moiety and a sulfanyl group. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory properties. The presence of the methyl group at the 4-position of the quinoline ring can influence the compound's reactivity and solubility. The sulfanyl group (-S-) attached to the quinoline enhances its potential for forming various derivatives through substitution reactions. Additionally, the acetic acid functional group contributes to the compound's acidity and can participate in hydrogen bonding, affecting its solubility in polar solvents. This compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. However, specific applications and biological activities would require further investigation through experimental studies. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₁₁NO₂S

InChI: InChI=1/C12H11NO2S/c1-8-6-11(16-7-12(14)15)13-10-5-3-2-4-9(8)10/h2-6H,7H2,1H3,(H,14,15)

SMILES: Cc1cc(nc2ccccc12)SCC(=O)O

Synonyms:

• [(4-Methylquinolin-2-yl)sulfanyl]acetic acid
• Acetic acid, 2-[(4-methyl-2-quinolinyl)thio]-

2-[(4-methylquinolin-2-yl)sulfanyl]acetic acid

CAS: 17880-62-5

Formula: C₁₂H₁₁NO₂S

Molecular weight: 233.2862

Ref: IN-DA0026BT

[(4-Methylquinolin-2-yl)sulfanyl]acetic acid

CAS: 17880-62-5

[(4-Methylquinolin-2-yl)sulfanyl]acetic acid is a chemical intermediate that is used in the synthesis of other organic compounds. It can be obtained by reacting acrylonitrile with potassium permanganate in water, followed by hydrolysis of the resulting manganese dioxide to give [(4-methylquinolin-2-yl)sulfanyl]acetic acid. This intermediate can also be synthesized from chloroacetic acid and ethyl bromoacetate, which are then converted to allyl bromide by reaction with potassium. The allyl bromide is then reacted with methyl methacrylate in the presence of amide to produce [(4-methylquinolin-2-yl)sulfanyl]acetic acid.

Formula: C₁₂H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 233.29 g/mol

Ref: 3D-SAA88062