CAS 1788041-61-1

D-Proline, 3-hydroxy-, methyl ester, hydrochloride (1:1), (3S)-rel-

Description:

D-Proline, 3-hydroxy-, methyl ester, hydrochloride (1:1), (3S)-rel- is a chemical compound characterized by its structural features as a derivative of proline, an amino acid. This compound includes a hydroxyl group at the 3-position of the proline ring, which contributes to its unique properties. The methyl ester functionality indicates that the carboxylic acid group of proline is esterified with methanol, enhancing its solubility and reactivity. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, which typically improves stability and solubility in aqueous solutions. As a chiral molecule, it exhibits stereochemistry, specifically the (3S)-configuration, which is important in biological systems and can influence its interaction with enzymes and receptors. This compound may have applications in pharmaceuticals, particularly in the development of peptide-based drugs or as a building block in organic synthesis. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied.

Formula: C₆H₁₁NO₃·ClH

InChI: InChI=1/C6H11NO3.ClH/c1-10-6(9)5-4(8)2-3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4-,5+;/s2

InChI key: InChIKey=FPZOEPPXPLBIAN-ZKOCKXBQNA-N

SMILES: C(OC)(=O)[C@H]1[C@@H](O)CCN1.Cl

Synonyms:

• D-Proline, 3-hydroxy-, methyl ester, hydrochloride (1:1), (3S)-rel-

METHYL (2R,3S)-3-HYDROXYPYRROLIDINE-2-CARBOXYLATE HCL

CAS: 1788041-61-1

Formula: C₆H₁₂ClNO₃

Purity: 97%

Molecular weight: 181.62

Ref: 10-F504703