CAS 1788054-82-9: 3-Pyridazinemethanamine, 5-methyl-, hydrochloride (1:1)
Description:3-Pyridazinemethanamine, 5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a primary amine group, contributing to its potential reactivity and solubility in polar solvents, particularly water, due to the presence of the hydrochloride salt form. The methyl group at the 5-position of the pyridazine ring influences its electronic properties and steric hindrance, which can affect its biological activity. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its interaction with biological targets and its pharmacokinetic profile. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities.
Formula:C6H9N3·ClH
InChI:InChI=1S/C6H9N3.ClH/c1-5-2-6(3-7)9-8-4-5;/h2,4H,3,7H2,1H3;1H
InChI key:InChIKey=IQVAAIQYKYLFOE-UHFFFAOYSA-N
SMILES:Cl.N=1N=C(C=C(C1)C)CN
- Synonyms:
- 3-Pyridazinemethanamine, 5-methyl-, hydrochloride (1:1)
3-Pyridazinemethanamine, 5-methyl-, hydrochloride (1:1)
Ref: IN-DA0026D0
| 1g | To inquire | ||
| 100mg | 550.00 € | ||
| 250mg | 620.00 € | ||
| 500mg | To inquire |
(5-Methylpyridazin-3-yl)methanamine hydrochloride
Ref: 10-F498329
| 1g | 1,183.00 € | ||
| 100mg | 334.00 € | ||
| 250mg | 517.00 € | ||
| 500mg | 846.00 € |
Ref: 54-OR304388
| 100mg | 613.00 € | ||
| 250mg | 983.00 € |
(5-Methylpyridazin-3-yl)methanamine hydrochloride
Ref: 3D-NWC05482
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
