CAS 178809-71-7

Uridine, 2′-deoxy-, 5′-(trihydrogen imidodiphosphate)

Description:

Uridine, 2′-deoxy-, 5′-(trihydrogen imidodiphosphate), commonly referred to as dUDP, is a nucleotide derivative characterized by its structure, which includes a deoxyribose sugar, a uracil base, and a triphosphate group. This compound plays a crucial role in cellular metabolism, particularly in the synthesis of DNA and RNA. The presence of the imidodiphosphate moiety enhances its stability and reactivity compared to standard triphosphates. dUDP is involved in various biochemical pathways, including nucleotide metabolism and the regulation of enzymatic reactions. Its solubility in aqueous solutions allows it to participate in cellular processes effectively. Additionally, dUDP can serve as a substrate for DNA polymerases during DNA replication and repair. The compound's CAS number, 178809-71-7, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, dUDP is an essential molecule in biochemistry, contributing to the fundamental processes of life.

Formula: C₉H₁₅N₃O₁₀P₂

InChI: InChI=1S/C9H15N3O10P2/c13-5-3-8(12-2-1-7(14)10-9(12)15)22-6(5)4-21-24(19,20)11-23(16,17)18/h1-2,5-6,8,13H,3-4H2,(H,10,14,15)(H4,11,16,17,18,19,20)/t5-,6+,8+/m0/s1

InChI key: InChIKey=COFNIXBQVWFHTR-SHYZEUOFSA-N

SMILES: O=C1N(C=CC(=O)N1)[C@@H]2O[C@H](COP(NP(=O)(O)O)(=O)O)[C@@H](O)C2

Synonyms:

• Uridine, 2′-deoxy-, 5′-(trihydrogen imidodiphosphate)

2'-Deoxyuridine-5'-[(a,b)-imido]diphosphate sodium salt - 10mM aqueous solution

CAS: 178809-71-7

2'-Deoxyuridine-5'-[(a,b)-imido]diphosphate sodium salt - 10mM aqueous solution is an organic compound that is used as a plant growth regulator. It inhibits the activity of plant enzymes, such as adenylate cyclase and protein kinase C, thereby blocking the production of proteins in plants. 2'-Deoxyuridine-5'-[(a,b)-imido]diphosphate sodium salt - 10mM aqueous solution has been shown to be toxic to muscle tissue and can cause acute toxicity in mammals. However, it has been found to be safe for use on plants when diluted with water.

Formula: C₉H₁₅N₃O₁₀P₂

Purity: Min. 95%

Molecular weight: 387.18 g/mol

Ref: 3D-ND45195