
CAS 178820-70-7
:Hydrazinium, 2-benzoyl-1-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-1-methyl-1-(phenylmethyl)-, inner salt, [S-(R*,R*)]-
Description:
Hydrazinium, 2-benzoyl-1-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-1-methyl-1-(phenylmethyl)-, inner salt, with CAS number 178820-70-7, is a complex organic compound characterized by its hydrazinium functional group and multiple substituents that contribute to its chemical properties. This substance typically exhibits properties associated with hydrazines, such as potential reactivity due to the presence of nitrogen atoms, which can participate in various chemical reactions, including oxidation and reduction processes. The presence of aromatic rings and functional groups like benzoyl and hydroxy can influence its solubility, stability, and interaction with biological systems. Additionally, the inner salt formation suggests that it may have enhanced stability in certain environments. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry and material science for their potential therapeutic effects or as intermediates in synthetic pathways. As with any chemical, safety data and handling precautions should be reviewed before use.
Formula:C30H37N3O4
InChI:InChI=1S/C30H37N3O4/c1-30(2,3)37-29(36)31-26(20-23-14-8-5-9-15-23)27(34)22-33(4,21-24-16-10-6-11-17-24)32-28(35)25-18-12-7-13-19-25/h5-19,26-27,34H,20-22H2,1-4H3,(H,31,36)/t26-,27-,33?/m0/s1
InChI key:InChIKey=CUQUROLDPALLNY-MCYRVCNVSA-N
SMILES:[N+](CC1=CC=CC=C1)(C[C@@H]([C@H](CC2=CC=CC=C2)NC(OC(C)(C)C)=O)O)([N-]C(=O)C3=CC=CC=C3)C
Synonyms:- Hydrazinium, 2-benzoyl-1-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-1-methyl-1-(phenylmethyl)-, inner salt, [S-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AQ 148
CAS:AQ 148 is a potent competitive inhibitor of HIV-1 PR.Formula:C30H37N3O4Color and Shape:SolidMolecular weight:503.63
