CymitQuimica logo

CAS 178933-04-5

:

(2S)-2-amino-3-(4-pyridyl)propanoic acid dihydrochloride

Description:
(2S)-2-amino-3-(4-pyridyl)propanoic acid dihydrochloride, also known as a derivative of amino acids, is characterized by its chiral center, which imparts specific stereochemical properties. This compound features an amino group, a carboxylic acid group, and a pyridine ring, contributing to its potential biological activity. The presence of the pyridyl group suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting other pharmacological effects. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's molecular structure allows for hydrogen bonding and other interactions, which are crucial for its reactivity and biological function. Additionally, its stability and solubility characteristics make it suitable for formulation in various drug delivery systems. Overall, (2S)-2-amino-3-(4-pyridyl)propanoic acid dihydrochloride is of interest in medicinal chemistry and research due to its potential therapeutic applications.
Formula:C8H10N2O2·2HCl
InChI:InChI=1S/C8H10N2O2.2ClH/c9-7(8(11)12)5-6-1-3-10-4-2-6;;/h1-4,7H,5,9H2,(H,11,12);2*1H/t7-;;/m0../s1
InChI key:NAMMTAFKUFJMSD-KLXURFKVSA-N
SMILES:c1cnccc1C[C@@H](C(=O)O)N.Cl.Cl
Found 4 products.