CymitQuimica logo

CAS 178948-42-0

:

PROLI/NO

Description:
PROLI/NO, with the CAS number 178948-42-0, is a chemical compound that functions primarily as a nitric oxide donor. It is characterized by its ability to release nitric oxide (NO) in biological systems, which plays a crucial role in various physiological processes, including vasodilation, neurotransmission, and immune response. The compound is often studied for its potential therapeutic applications, particularly in cardiovascular health and as a signaling molecule in cellular processes. PROLI/NO is typically soluble in aqueous solutions, making it suitable for biological assays and experiments. Its stability and release kinetics can vary depending on environmental conditions, such as pH and temperature. As a nitric oxide donor, it is important to handle PROLI/NO with care, as nitric oxide can be reactive and has implications for cellular signaling and oxidative stress. Overall, PROLI/NO serves as a valuable tool in research and potential clinical applications related to nitric oxide biology.
Formula:C5H9N3O4·2Na
InChI:InChI=1S/C5H9N3O4.2Na/c9-5(10)4-2-1-3-7(4)8(12)6-11;;/h4,11H,1-3H2,(H,9,10);;/t4-;;/m0../s1
InChI key:InChIKey=VTJBWUNMAQATGA-FHNDMYTFSA-N
SMILES:N(=NO)(=O)N1[C@H](C(O)=O)CCC1.[Na]
Synonyms:
  • L-Proline, 1-(2-hydroxy-1-oxidodiazenyl)-, sodium salt (1:2)
  • PROLI/NO
  • L-Proline, 1-(hydroxy-NNO-azoxy)-, disodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.