CymitQuimica logo

CAS 179011-39-3

:

1,5-Difluoro-2-methoxy-4-nitrobenzene

Description:
1,5-Difluoro-2-methoxy-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms, a methoxy group, and a nitro group. The presence of the difluoro substituents indicates that the compound exhibits unique electronic properties, potentially influencing its reactivity and interaction with other molecules. The methoxy group contributes to the compound's solubility in organic solvents and may also affect its polarity. The nitro group is known for its electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic aromatic substitution reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Additionally, the specific arrangement of substituents on the benzene ring can lead to distinct physical and chemical properties, such as melting point, boiling point, and spectral characteristics, which are important for its identification and utilization in research and industrial applications.
Formula:C7H5F2NO3
InChI:InChI=1/C7H5F2NO3/c1-13-7-3-6(10(11)12)4(8)2-5(7)9/h2-3H,1H3
InChI key:UWQOVGHBTZMFAF-UHFFFAOYSA-N
SMILES:COc1cc(c(cc1F)F)N(=O)=O
Synonyms:
  • 2,4-Difluoro-5-nitrophenyl methyl ether
  • Benzene, 1,5-Difluoro-2-Methoxy-4-Nitro-
  • 2,4-Difluoro-5-nitroanisole
Found 4 products.