CymitQuimica logo

CAS 179055-42-6

:

N-(pyridin-3-ylmethyl)cycloheptanamine

Description:
N-(pyridin-3-ylmethyl)cycloheptanamine, with the CAS number 179055-42-6, is a chemical compound characterized by its unique structure that combines a cycloheptane ring with a pyridine moiety. This compound features an amine functional group, which contributes to its potential as a ligand in various chemical reactions and biological applications. The presence of the pyridine ring, a six-membered aromatic ring containing nitrogen, imparts specific electronic properties, making it suitable for interactions with metal ions or other biological targets. The cycloheptane structure adds a degree of flexibility and steric hindrance, which can influence the compound's reactivity and binding affinity. N-(pyridin-3-ylmethyl)cycloheptanamine may exhibit interesting pharmacological properties, potentially acting as a neurotransmitter modulator or in other therapeutic roles. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, making it a subject of interest in medicinal chemistry and drug design.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-2-4-8-13(7-3-1)15-11-12-6-5-9-14-10-12/h5-6,9-10,13,15H,1-4,7-8,11H2
SMILES:C1CCCC(CC1)NCc1cccnc1
Synonyms:
  • 3-pyridinemethanamine, N-cycloheptyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.