CAS 179057-20-6

3-(1H-Tetrazol-5-yl)benzyl alcohol, 97%

Description:

3-(1H-Tetrazol-5-yl)benzyl alcohol is an organic compound characterized by the presence of a benzyl alcohol moiety and a tetrazole ring. The tetrazole group, a five-membered heterocyclic compound containing four nitrogen atoms, imparts unique chemical properties, including potential for coordination with metal ions and biological activity. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of the hydroxyl (-OH) group in the benzyl alcohol structure contributes to its reactivity, allowing for further functionalization. It is often used in medicinal chemistry and material science due to its potential pharmacological properties and ability to act as a building block in the synthesis of more complex molecules. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use.

Formula: C₈H₈N₄O

InChI: InChI=1/C8H8N4O/c13-5-6-2-1-3-7(4-6)8-9-11-12-10-8/h1-4,13H,5H2,(H,9,10,11,12)

SMILES: c1cc(cc(c1)c1n[nH]nn1)CO

Synonyms:

• [3-(1H-tetrazol-5-yl)phenyl]methanol

Benzenemethanol, 3-(2H-tetrazol-5-yl)-

CAS: 179057-20-6

Formula: C₈H₈N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.1753

Ref: IN-DA0026QL

[3-(1H-tetrazol-5-yl)phenyl]methanol

CAS: 179057-20-6

Formula: C₈H₈N₄O

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 176.179

Ref: 10-F310620

5-[3-(Hydroxymethyl)phenyl]-2H-tetrazole

CAS: 179057-20-6

Versatile small molecule scaffold

Formula: C₈H₈N₄O

Purity: Min. 95%

Molecular weight: 176.18 g/mol

Ref: 3D-EHA05720