CAS 179057-34-2

4-(1H-PYRAZOL-1-YLMETHYL)BENZONITRILE

Description:

4-(1H-Pyrazol-1-ylmethyl)benzonitrile is an organic compound characterized by its pyrazole and benzonitrile functional groups. It features a pyrazole ring, which is a five-membered heterocyclic compound containing two nitrogen atoms, attached to a benzene ring via a methylene (-CH2-) bridge. The presence of the nitrile group (-C≡N) indicates that it has a carbon atom triple-bonded to a nitrogen atom, contributing to its reactivity and potential applications in various chemical reactions. This compound is typically used in medicinal chemistry and material science due to its ability to act as a building block for more complex molecules. Its structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and a distinct melting point, which are important for its practical applications. Overall, 4-(1H-pyrazol-1-ylmethyl)benzonitrile is a versatile compound with significant implications in research and industry.

Formula: C₁₁H₉N₃

InChI: InChI=1/C11H9N3/c12-8-10-2-4-11(5-3-10)9-14-7-1-6-13-14/h1-7H,9H2

SMILES: c1cnn(c1)Cc1ccc(cc1)C#N

Synonyms:

• 4-(1H-Pyrazol-1-ylmethyl)benzonitrile 97%

BENZONITRILE, 4-(1H-PYRAZOL-1-YLMETHYL)-

CAS: 179057-34-2

Formula: C₁₁H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.2093

Ref: IN-DA0026QH

4-(1H-Pyrazol-1-ylmethyl)benzonitrile

CAS: 179057-34-2

4-(1H-Pyrazol-1-ylmethyl)benzonitrile

Purity: 95%

Molecular weight: 183.20926g/mol

Ref: 54-OR9613

4-((1H-pyrazol-1-yl)methyl)benzonitrile

CAS: 179057-34-2

Purity: 95%

Molecular weight: 183.2140045

Ref: 10-F771260

4-(1H-Pyrazol-1-ylmethyl)benzonitrile

CAS: 179057-34-2

4-((1H-Pyrazol-1-yl)methyl)benzonitrile is a chemical compound that is used as an antidepressant in psychiatric patients. It has been shown to have a positive effect on the mood of patients with major depressive disorder and bipolar disorder, but does not have significant effects on the overall sleep patterns. The drug has also been shown to be effective against cancer, specifically colorectal cancer. This medication has a low energy profile and no serious adverse effects on the cardiovascular system.

Formula: C₁₁H₉N₃

Purity: Min. 95%

Molecular weight: 183.21 g/mol

Ref: 3D-EHA05734