CymitQuimica logo

CAS 17909-34-1

:

chloromethyl-[chloromethyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane

Description:
Chloromethyl-[chloromethyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane, with CAS number 17909-34-1, is a silane compound characterized by its complex structure that includes multiple trimethylsilyloxy groups and chloromethyl functionalities. This compound typically exhibits properties associated with silanes, such as reactivity with moisture, which can lead to hydrolysis and subsequent condensation reactions, forming siloxane networks. It is often used in applications involving surface modification, adhesion promotion, and as a coupling agent in various materials, including polymers and ceramics. The presence of chloromethyl groups suggests potential reactivity, making it useful in organic synthesis and as an intermediate in the production of more complex silane derivatives. Additionally, the trimethylsilyloxy groups enhance the compound's stability and compatibility with organic substrates. Overall, this silane is significant in materials science and chemistry for its multifunctional properties and potential applications in enhancing material performance.
Formula:C14H40Cl2O5Si6
InChI:InChI=1/C14H40Cl2O5Si6/c1-22(2,3)17-26(13-15,18-23(4,5)6)21-27(14-16,19-24(7,8)9)20-25(10,11)12/h13-14H2,1-12H3
SMILES:C[Si](C)(C)O[Si](CCl)(O[Si](C)(C)C)O[Si](CCl)(O[Si](C)(C)C)O[Si](C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.