CAS 17910-73-5

2-Hydroxy-5-dibenzosuberone

Description:

2-Hydroxy-5-dibenzosuberone, with the CAS number 17910-73-5, is an organic compound characterized by its unique structure, which includes a hydroxyl group (-OH) and dibenzosuberone moiety. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity due to the presence of the hydroxyl group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic characteristics. The compound may also display interesting reactivity due to the presence of the hydroxyl group, which can participate in various chemical reactions, including esterification and oxidation. Additionally, its dibenzosuberone framework may contribute to its stability and influence its interactions with biological systems. Overall, 2-Hydroxy-5-dibenzosuberone is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications and unique structural features.

Formula: C₁₃H₁₄N₂

InChI: InChI=1/C13H14N2/c14-12(13-8-4-5-9-15-13)10-11-6-2-1-3-7-11/h1-9,12H,10,14H2

SMILES: c1ccc(cc1)CC(c1ccccn1)N

Synonyms:

• DCHD Linker, Dibenzocyclohepta-1,4-diene Linker
• 2-Phenyl-1-(Pyridin-2-Yl)Ethanamine

5H-Dibenzo[a,d]cyclohepten-5-one, 10,11-dihydro-2-hydroxy-

CAS: 17910-73-5

Formula: C₁₅H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.2546

Ref: IN-DA0026T3

2-Hydroxy-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one

CAS: 17910-73-5

2-Hydroxy-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one

Purity: 98%

Molecular weight: 224.25g/mol

Ref: 54-OR96557

2-Hydroxy-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one

CAS: 17910-73-5

Purity: 95.0%

Color and Shape: Solid, Greyish powder

Molecular weight: 224.25900268554688

Ref: 10-F226087