CAS 179113-90-7
:3-Trifluoromethoxyphenylboronic acid
Description:
3-Trifluoromethoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a trifluoromethoxy group. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with solubility in polar solvents like water and alcohols due to the boronic acid moiety. The trifluoromethoxy group enhances its electronic properties, making it useful in various applications, including medicinal chemistry and organic synthesis. Boronic acids are known for their ability to form reversible complexes with diols, which is significant in the development of sensors and in drug design. Additionally, 3-Trifluoromethoxyphenylboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules. Safety data should be consulted for handling, as boronic acids can be irritants and require appropriate safety measures during use.
Formula:C7H6BF3O3
InChI:InChI=1/C7H6BF3O3/c9-7(10,11)14-6-3-1-2-5(4-6)8(12)13/h1-4,12-13H
SMILES:c1cc(cc(c1)OC(F)(F)F)B(O)O
Synonyms:- 3-(Trifluoromethoxy)phenylboronic acid
- 3-(Trifluoromethoxy)benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H6BF3O3Purity:97.0 to 110.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:205.933-(Trifluoromethoxy)benzeneboronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H6BF3O3Purity:98%Color and Shape:White, PowderMolecular weight:205.93Boronic acid, B-[3-(trifluoromethoxy)phenyl]-
CAS:Formula:C7H6BF3O3Purity:97%Color and Shape:SolidMolecular weight:205.92693-(Trifluoromethoxy)benzeneboronic acid
CAS:<p>3-(Trifluoromethoxy)benzeneboronic acid</p>Formula:C7H6BF3O3Purity:98%Color and Shape: off white crystalline solidMolecular weight:205.93g/mol3-Trifluoromethoxyphenylboronic acid
CAS:<p>3-Trifluoromethoxyphenylboronic acid is a lead compound that has the potential to be an efficient and water-soluble inhibitor of protein kinases. It has been shown to have a significant inhibitory effect on vismodegib transport. This compound may also have anticancer properties. 3-Trifluoromethoxyphenylboronic acid binds to the active site of protein kinases, blocking their catalytic activity and inhibiting cell proliferation by interfering with the signaling pathway that regulates cancer cells.</p>Formula:C7H6BF3O3Purity:Min. 90%Color and Shape:PowderMolecular weight:205.93 g/mol3-(Trifluoromethoxy)benzeneboronic acid
CAS:Formula:C7H6BF3O3Purity:97%Color and Shape:SolidMolecular weight:205.93






