CAS 17913-76-7

2,4,7,9-Tetramethyldecane-4,7-diol

Description:

2,4,7,9-Tetramethyldecane-4,7-diol is an organic compound characterized by its structure, which includes a long carbon chain with multiple methyl groups and hydroxyl (–OH) functional groups. This compound belongs to the class of alcohols due to the presence of two hydroxyl groups, which contribute to its solubility in polar solvents and influence its reactivity. The presence of four methyl groups enhances its hydrophobic characteristics, making it less soluble in water compared to simpler alcohols. The specific arrangement of the methyl groups and hydroxyls gives rise to unique physical properties, such as a relatively high boiling point and viscosity. Additionally, the compound may exhibit interesting chemical behavior, including potential for hydrogen bonding and reactivity in various organic reactions. Its applications can range from use in chemical synthesis to potential roles in materials science, depending on its specific properties and reactivity. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₄H₃₀O₂

InChI: InChI=1S/C14H30O2/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4/h11-12,15-16H,7-10H2,1-6H3

InChI key: InChIKey=BTRWELPXUDWAGW-UHFFFAOYSA-N

SMILES: C(CCC(CC(C)C)(C)O)(CC(C)C)(C)O

Synonyms:

• 2,4,7,9-Tetramethyldecane-4,7-diol
• NSC 14264
• EnviroGem AD 01
• 2,4,7,9-Tetramethyl-4,7-decanediol
• 4,7-Decanediol, 2,4,7,9-tetramethyl-

4,7-Decanediol, 2,4,7,9-tetramethyl-

CAS: 17913-76-7

Formula: C₁₄H₃₀O₂

Molecular weight: 230.3868

Ref: IN-DA0026TO