CymitQuimica logo

CAS 179251-57-1

:

2-broMo-4-(Methyloxy)benzenesulfonyl chloride

Description:
2-Bromo-4-(methyloxy)benzenesulfonyl chloride, with the CAS number 179251-57-1, is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions. This compound features a bromine atom and a methoxy group attached to a benzene ring, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, which are useful in the synthesis of various organic compounds. Additionally, the methoxy group can influence the compound's solubility and reactivity, while the bromine atom can serve as a leaving group in certain reactions. This compound is typically used in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. As with many sulfonyl chlorides, it is important to handle this substance with care due to its potential reactivity and the release of hydrochloric acid upon hydrolysis. Proper safety measures should be observed when working with this chemical.
Formula:C7H6BrClO3S
InChI:InChI=1S/C7H6BrClO3S/c1-12-5-2-3-6(8)7(4-5)13(9,10)11/h2-4H,1H3
InChI key:SLYMSNAGJFGCDV-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)Br)S(=O)(=O)Cl
Found 4 products.