CAS 17928-28-8: Methyltris(trimethylsiloxy)silane
Description:Methyltris(trimethylsiloxy)silane, with the CAS number 17928-28-8, is an organosilicon compound characterized by its silane structure, which includes a methyl group and three trimethylsiloxy groups. This compound is typically a colorless, viscous liquid that exhibits low volatility and high thermal stability, making it suitable for various applications in the silicone industry. It is known for its excellent hydrophobic properties, which enhance water repellency in formulations. Methyltris(trimethylsiloxy)silane is often used as a silane coupling agent, promoting adhesion between organic materials and inorganic substrates, and is also utilized in the production of silicone polymers and coatings. Its chemical stability and compatibility with a range of materials make it valuable in sealants, adhesives, and surface treatments. Additionally, it can act as a precursor in the synthesis of more complex siloxane compounds. Safety data indicates that, while it may pose some health risks upon inhalation or skin contact, proper handling and safety measures can mitigate these concerns.
Formula:C10H30O3Si4
InChI:InChI=1S/C10H30O3Si4/c1-14(2,3)11-17(10,12-15(4,5)6)13-16(7,8)9/h1-10H3
InChI key:InChIKey=RGMZNZABJYWAEC-UHFFFAOYSA-N
SMILES:O([Si](O[Si](C)(C)C)(O[Si](C)(C)C)C)[Si](C)(C)C
- Synonyms:
- (2,5-Dimethoxyphenyl)Acetonitrile
- 1,1,1,3,5,5,5-Heptamethyl-3-((trimethylsilyl)oxy)trisiloxane
- 1,1,1,3,5,5,5-Heptamethyl-3-(trimethylsiloxy)trisiloxane
- Tmf 1.5
- Tris(trimethylsiloxy)methylsilane
- Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-3-((trimethylsilyl)oxy)-
- Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-3-(trimethylsiloxy)-
- Unii-S73Zqi0Gxm
- Methyltris(trimethylsiloxy)silane