CAS 17928-31-3
:1,7-DIMETHOXY OCTAMETHYLTETRASILOXANE
Description:
1,7-Dimethoxy octamethylcyclotetrasiloxane, with the CAS number 17928-31-3, is a siloxane compound characterized by its unique structure, which includes a cyclic arrangement of silicon and oxygen atoms. This compound features two methoxy groups attached to the 1 and 7 positions of the octamethylcyclotetrasiloxane ring, enhancing its chemical reactivity and solubility in various organic solvents. It typically exhibits low viscosity and high thermal stability, making it suitable for applications in cosmetics, personal care products, and as a lubricant or release agent in industrial processes. The presence of methoxy groups can also influence its interaction with other substances, potentially improving compatibility with organic materials. Additionally, this compound is generally considered to have low toxicity, although safety data should always be consulted for specific applications. Its unique properties make it valuable in formulations requiring silicone-based ingredients, contributing to improved texture and performance in end products.
Formula:C7H6ClNO5S
InChI:InChI=1/C7H6ClNO5S/c1-14-5-2-3-7(15(8,12)13)6(4-5)9(10)11/h2-4H,1H3
InChI key:InChIKey=BTQLIKNMLWCRII-UHFFFAOYSA-N
SMILES:COc1ccc(c(c1)N(=O)=O)S(=O)(=O)Cl
Synonyms:- 1,1,3,3,5,5,7,7-Octamethyl-1,7-dimethoxytetrasiloxane
- 1,7-Dimethoxy-1,1,3,3,5,5,7,7-Octamethyl-Tetrasiloxan
- 1,7-Dimethoxy-1,1,3,3,5,5,7,7-octamethyltetrasiloxane
- 1,7-Dimethoxyoctamethyltetrasiloxane
- 4-Methoxy-2-Nitrobenzenesulfonyl Chloride
- Tetrasiloxane, 1,7-dimethoxy-1,1,3,3,5,5,7,7-octamethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tetrasiloxane, 1,7-dimethoxy-1,1,3,3,5,5,7,7-octamethyl-
CAS:Formula:C10H30O5Si4Molecular weight:342.68421,7-Dimethoxy octamethyltetrasiloxane
CAS:S06830 - 1,7-Dimethoxy octamethyltetrasiloxane
Formula:C10H30O5Si4Color and Shape:Liquid, ClearMolecular weight:342.685

