CymitQuimica logo

CAS 179324-86-8

:

4,6-Methano-1,3,2-benzodioxaborole-2-methanamine

Description:
4,6-Methano-1,3,2-benzodioxaborole-2-methanamine, with the CAS number 179324-86-8, is a chemical compound that features a unique bicyclic structure incorporating a boron atom within a dioxaborole framework. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the methanamine group suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the boron atom in its structure can confer unique reactivity and coordination properties, making it a candidate for further studies in organoboron chemistry. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 4,6-Methano-1,3,2-benzodioxaborole-2-methanamine represents a fascinating area of study within the field of organic and medicinal chemistry, with potential implications for drug design and development.
Formula:C8H8BNO2
InChI:InChI=1/C8H8BNO2/c10-4-9-11-7-3-5-1-6(2-5)8(7)12-9/h1,3H,2,4,10H2
SMILES:c1c2Cc1c1c(c2)OB(CN)O1
Synonyms:
  • (R)-BoroLeu-(+)-Pinanediol
  • 1-(4,6-Methano-1,3,2-Benzodioxaborol-2-Yl)Methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.