CAS 17933-29-8

7-methylidenebicyclo[3.3.1]nonan-3-one

Description:

7-Methylidenebicyclo[3.3.1]nonan-3-one, identified by its CAS number 17933-29-8, is an organic compound characterized by its bicyclic structure, which consists of a nonane framework with a ketone functional group and a methylidene substituent. This compound features a unique arrangement of carbon atoms that contributes to its distinct chemical properties. The presence of the ketone group indicates that it can participate in various chemical reactions, such as nucleophilic additions or reductions. The bicyclic nature of the molecule may impart rigidity, influencing its reactivity and interactions with other substances. Additionally, the methylidene group can enhance the compound's reactivity due to the presence of a double bond, making it a potential candidate for further chemical transformations. Its structural characteristics may also affect its physical properties, such as boiling point and solubility, which are important for applications in organic synthesis and material science. Overall, 7-methylidenebicyclo[3.3.1]nonan-3-one is a compound of interest in organic chemistry due to its unique structure and potential reactivity.

Formula: C₁₀H₁₄O

InChI: InChI=1/C10H14O/c1-7-2-8-4-9(3-7)6-10(11)5-8/h8-9H,1-6H2

SMILES: C=C1CC2CC(C1)CC(=O)C2

Bicyclo[3.3.1]nonan-3-one, 7-methylene-

CAS: 17933-29-8

Formula: C₁₀H₁₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 150.2176

Ref: IN-DA0026XP

3-Methylenebicyclo[3.3.1]nonan-7-one

CAS: 17933-29-8

3-Methylenebicyclo[3.3.1]nonan-7-one

Purity: ≥95%

Molecular weight: 150.22g/mol

Ref: 54-OR0622

7-Methylenebicyclo[3.3.1]nonan-3-one

CAS: 17933-29-8

Purity: 95.0%

Molecular weight: 150.2209930419922

Ref: 10-F242722

3-Methylenebicyclo[3.3.1]nonan-7-one

CAS: 17933-29-8

3-Methylenebicyclo[3.3.1]nonan-7-one is a chiral molecule that has been synthesized as a racemic mixture of two enantiomers. This compound is an amine with a hydroxy group and an isopropyl side chain. It has been shown to have anti-inflammatory properties, which may be due to its ability to inhibit cyclooxygenase and lipoxygenase activity. 3-Methylenebicyclo[3.3.1]nonan-7-one also has antiviral properties, which are due to its inhibition of protein synthesis in viruses by blocking the activity of ribonucleotide reductase, an enzyme required for nucleic acid synthesis. The reaction mechanism involves the formation of a covalent bond between the amantadine and the active site of ribonucleotide reductase through either radical or hydrogen atom transfer mechanisms.

Formula: C₁₀H₁₄O

Purity: Min. 95%

Molecular weight: 150.22 g/mol

Ref: 3D-SAA93329