CAS 179334-10-2
:1-[(3-fluorophenyl)carbonyl]piperazine
Description:
1-[(3-fluorophenyl)carbonyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine containing two nitrogen atoms. The presence of a carbonyl group attached to a 3-fluorophenyl moiety indicates that this compound has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The fluorine atom on the phenyl ring can enhance the compound's lipophilicity and metabolic stability, which are desirable properties in drug design. Additionally, the piperazine structure is known for its ability to interact with various biological targets, making it a versatile scaffold in drug discovery. The compound's molecular structure suggests it may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Overall, 1-[(3-fluorophenyl)carbonyl]piperazine represents a compound of interest in the field of organic and medicinal chemistry, with potential implications for therapeutic applications.
Formula:C11H13FN2O
InChI:InChI=1/C11H13FN2O/c12-10-3-1-2-9(8-10)11(15)14-6-4-13-5-7-14/h1-3,8,13H,4-7H2
SMILES:c1cc(cc(c1)F)C(=O)N1CCNCC1
Synonyms:- (3-Fluorophenyl)(piperazin-1-yl)methanone
- Methanone, (3-fluorophenyl)-1-piperazinyl-
- 3-FLUOROBENZOIC ACID, PIPERAZIDE
- (3-FLUORO-PHENYL)-PIPERAZIN-1-YL-METHANONE
- 1-(3-FLUOROBENZOYL)PIPERAZINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

