CAS 179344-98-0
:1-[2-(Ethenyloxy)-1-oxidodiazenyl]pyrrolidine
Description:
1-[2-(Ethenyloxy)-1-oxidodiazenyl]pyrrolidine, with the CAS number 179344-98-0, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a diazenyl group, which consists of two nitrogen atoms connected by a double bond, and an ethenyloxy substituent that contributes to its reactivity and potential applications in organic synthesis. The presence of the ethenyloxy group suggests that the compound may participate in various chemical reactions, including polymerization or cross-linking processes. Additionally, the oxidized diazenyl moiety can impart unique properties, such as increased stability or specific reactivity under certain conditions. The compound's structure indicates potential utility in fields such as materials science, medicinal chemistry, or as an intermediate in the synthesis of more complex molecules. However, detailed studies on its physical properties, reactivity, and safety profile would be necessary to fully understand its applications and implications in various chemical contexts.
Formula:C6H11N3O2
InChI:InChI=1S/C6H11N3O2/c1-2-11-7-9(10)8-5-3-4-6-8/h2H,1,3-6H2
InChI key:InChIKey=RJWXCQACZTVGIN-UHFFFAOYSA-N
SMILES:N(=NOC=C)(=O)N1CCCC1
Synonyms:- (Ethenyloxy)[(pyrrolidin-1-yl)-oxo-λ5-azanylidene]amine
- 1-[(Z)-(ethenyloxy)-NNO-azoxy]pyrrolidine
- 1-[2-(Ethenyloxy)-1-oxidodiazenyl]pyrrolidine
- O<sup>2</sup>-Vinyl 1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate
- Pyrrolidine, 1-[(ethenyloxy)-NNO-azoxy]-
- Pyrrolidine, 1-[2-(ethenyloxy)-1-oxidodiazenyl]-
- V-Pyrro/No
- O2-Vinyl 1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pyrrolidine, 1-[2-(ethenyloxy)-1-oxidodiazenyl]-
CAS:Formula:C6H11N3O2Color and Shape:LiquidMolecular weight:157.1704V-PYRRO/NO
CAS:V-PYRRO/NO is a NO donor in vivo. Following hepatic metabolism, it spontaneously decomposes with a half-life of 3 seconds to liberate NO.Formula:C6H11N3O2Color and Shape:SolidMolecular weight:157.17

