CAS 17938-09-9
:1,1,3,3-Tetramethoxy-1,3-diphenyldisiloxane
Description:
1,1,3,3-Tetramethoxy-1,3-diphenyldisiloxane is an organosilicon compound characterized by its unique siloxane backbone, which consists of silicon-oxygen bonds. This compound features two phenyl groups and four methoxy groups attached to the silicon atoms, contributing to its distinctive chemical properties. It is typically a colorless to pale yellow liquid with low volatility and moderate viscosity. The presence of methoxy groups enhances its solubility in organic solvents, while the phenyl groups provide stability and potential for various applications in materials science and organic synthesis. This compound is often utilized in the formulation of silicone-based materials, coatings, and sealants due to its ability to impart desirable mechanical and thermal properties. Additionally, its structure allows for potential reactivity in further chemical transformations, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H22O5Si2
InChI:InChI=1/C16H22O5Si2/c1-17-22(18-2,15-11-7-5-8-12-15)21-23(19-3,20-4)16-13-9-6-10-14-16/h5-14H,1-4H3
InChI key:InChIKey=KCCVBXQGWAXUSD-UHFFFAOYSA-N
SMILES:[Si](O[Si](OC)(OC)C1=CC=CC=C1)(OC)(OC)C2=CC=CC=C2
Synonyms:- 1,1,3,3-Tetramethoxy-1,3-Diphenyldisiloxane
- 1,3-Diphenyltetramethoxydisiloxane 92%
- Diphenyl tetramethoxydisiloxane
- Disiloxane, 1,1,3,3-tetramethoxy-1,3-diphenyl-
- 1,3 Diphenyl tetramethoxy disiloxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3 Diphenyl tetramethoxy disiloxane
CAS:S08105 - 1,3 Diphenyl tetramethoxy disiloxane
Formula:C16H22O5Si2Color and Shape:Liquid, ClearMolecular weight:350.517

