CAS 179388-65-9
:4-imino-1-(2-phenylphenoxy)-4-(1-piperidyl)butan-2-ol hydrochloride
Description:
4-Imino-1-(2-phenylphenoxy)-4-(1-piperidyl)butan-2-ol hydrochloride is a chemical compound characterized by its complex structure, which includes a piperidine ring, a phenyl group, and a butanol moiety. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents due to the presence of hydroxyl and amine functionalities. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, making it suitable for various applications, including pharmaceutical research. The imino group contributes to its reactivity, potentially allowing for interactions with biological targets. Additionally, the presence of the phenoxy group may influence its lipophilicity and biological activity. Overall, this compound's unique structural features suggest it may have interesting pharmacological properties, warranting further investigation in medicinal chemistry contexts. However, specific biological activities and safety profiles would require empirical studies to establish its efficacy and toxicity.
Formula:C21H27ClN2O2
InChI:InChI=1/C21H26N2O2.ClH/c22-21(23-13-7-2-8-14-23)15-18(24)16-25-20-12-6-5-11-19(20)17-9-3-1-4-10-17;/h1,3-6,9-12,18,22,24H,2,7-8,13-16H2;1H
SMILES:c1ccc(cc1)c1ccccc1OCC(CC(=N)N1CCCCC1)O.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Piperidinepropanol, α-[([1,1'-biphenyl]-2-yloxy)methyl]-γ-imino-, hydrochloride (1:1)
CAS:Formula:C21H27ClN2O2Molecular weight:374.90431-([1,1'-Biphenyl]-2-yloxy)-4-imino-4-(piperidin-1-yl)butan-2-ol Hydrochloride
CAS:Controlled ProductFormula:C21H26N2O2·HClColor and Shape:NeatMolecular weight:374.904aH 11110 Hydrochloride
CAS:aH 11110 Hydrochloride is an analytical standard for HPLC. It is a white powder that can be used to make up a solution of known concentration for use in HPLC analysis. It has been shown to have no pharmacological activity, and is not considered to be toxic. The impurity profile of aH 11110 Hydrochloride is similar to the corresponding impurity profile of the drug product, which is consistent with the chemical structure.
Formula:C21H27ClN2O2Purity:Min. 95%Molecular weight:374.9 g/mol



