CAS 179388-65-9

4-imino-1-(2-phenylphenoxy)-4-(1-piperidyl)butan-2-ol hydrochloride

Description:

4-Imino-1-(2-phenylphenoxy)-4-(1-piperidyl)butan-2-ol hydrochloride is a chemical compound characterized by its complex structure, which includes a piperidine ring, a phenyl group, and a butanol moiety. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents due to the presence of hydroxyl and amine functionalities. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, making it suitable for various applications, including pharmaceutical research. The imino group contributes to its reactivity, potentially allowing for interactions with biological targets. Additionally, the presence of the phenoxy group may influence its lipophilicity and biological activity. Overall, this compound's unique structural features suggest it may have interesting pharmacological properties, warranting further investigation in medicinal chemistry contexts. However, specific biological activities and safety profiles would require empirical studies to establish its efficacy and toxicity.

Formula: C₂₁H₂₇ClN₂O₂

InChI: InChI=1/C21H26N2O2.ClH/c22-21(23-13-7-2-8-14-23)15-18(24)16-25-20-12-6-5-11-19(20)17-9-3-1-4-10-17;/h1,3-6,9-12,18,22,24H,2,7-8,13-16H2;1H

SMILES: c1ccc(cc1)c1ccccc1OCC(CC(=N)N1CCCCC1)O.Cl

1-Piperidinepropanol, α-[([1,1'-biphenyl]-2-yloxy)methyl]-γ-imino-, hydrochloride (1:1)

CAS: 179388-65-9

Formula: C₂₁H₂₇ClN₂O₂

Molecular weight: 374.9043

Ref: IN-DA0026ZP

AH 11110

CAS: 179388-65-9

Formula: C₂₁H₂₆N₂O₂·HCl

Molecular weight: 374.90

Ref: 7W-GK6947

1-([1,1'-Biphenyl]-2-yloxy)-4-imino-4-(piperidin-1-yl)butan-2-ol Hydrochloride

Controlled Product

CAS: 179388-65-9

Formula: C₂₁H₂₆N₂O₂·HCl

Color and Shape: Neat

Molecular weight: 374.904

Ref: TR-A434503

aH 11110 Hydrochloride

CAS: 179388-65-9

aH 11110 Hydrochloride is an analytical standard for HPLC. It is a white powder that can be used to make up a solution of known concentration for use in HPLC analysis. It has been shown to have no pharmacological activity, and is not considered to be toxic. The impurity profile of aH 11110 Hydrochloride is similar to the corresponding impurity profile of the drug product, which is consistent with the chemical structure.

Formula: C₂₁H₂₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 374.9 g/mol

Ref: 3D-EHA38865