CymitQuimica logo

CAS 1794-34-9

:

1H-pyrazole-1-carbothioamide

Description:
1H-pyrazole-1-carbothioamide, with the CAS number 1794-34-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carbothioamide functional group, which consists of a carbonyl group (C=O) bonded to a thiol (–SH) group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the thiol group. The compound is of interest in medicinal chemistry and agricultural applications, as derivatives of pyrazole have been studied for their anti-inflammatory, analgesic, and antimicrobial properties. Additionally, the presence of the thiocarbonyl group can enhance its reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken.
Formula:C4H5N3S
InChI:InChI=1/C4H5N3S/c5-4(8)7-3-1-2-6-7/h1-3H,(H2,5,8)
SMILES:c1cnn(c1)C(=N)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.