CymitQuimica logo

CAS 179408-54-9

:

6-(2-Thienyl)-3-pyridinecarboxylic acid

Description:
6-(2-Thienyl)-3-pyridinecarboxylic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of both the thienyl and pyridine rings imparts distinct electronic and steric characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The thienyl group can enhance the compound's lipophilicity, while the pyridine moiety may facilitate interactions with biological targets. Additionally, the compound's solubility and reactivity can be influenced by the carboxylic acid group, which can participate in hydrogen bonding and other intermolecular interactions. Overall, 6-(2-Thienyl)-3-pyridinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science, owing to its unique structural features and functional groups.
Formula:C10H7NO2S
InChI:InChI=1S/C10H7NO2S/c12-10(13)7-3-4-8(11-6-7)9-2-1-5-14-9/h1-6H,(H,12,13)
InChI key:InChIKey=QYGFXNUFKLRCRB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N=C1)C2=CC=CS2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-(2-thienyl)-
  • 6-(2-Thienyl)-3-pyridinecarboxylic acid
  • 6-(2-Thienyl)pyridine-3-carboxylic acid
  • 6-(Thiophen-2-yl)nicotinic acid
  • 6-Thien-2-Ylnicotinic Acid
Found 3 products.