CAS 1795-31-9: Silanol, 1,1,1-trimethyl-, 1,1′,1′′-phosphite
Description:Silanol, 1,1,1-trimethyl-, 1,1′,1′′-phosphite, with the CAS number 1795-31-9, is an organophosphorus compound characterized by its silanol and phosphite functional groups. This compound typically exhibits a colorless to pale yellow appearance and is known for its moderate volatility. It is soluble in organic solvents and has limited solubility in water due to the presence of hydrophobic trimethyl groups. The presence of the phosphite moiety imparts certain reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis and as a potential stabilizer or additive in polymer formulations. Additionally, silanol groups can participate in hydrogen bonding, influencing the compound's physical properties and reactivity. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C9H27O3PSi3
InChI:InChI=1S/C9H27O3PSi3/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h1-9H3
InChI key:InChIKey=VMZOBROUFBEGAR-UHFFFAOYSA-N
SMILES:O(P(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C
- Synonyms:
- Phosphorous acid tris(trimethylsilyl) ester
- Phosphorousacidtrimethylsilylester
- Silanol, 1,1,1-trimethyl-, 1,1′,1′′-phosphite
- Silanol, trimethyl-, phosphite
- Silanol, trimethyl-, phosphite (3:1)
- Tmsp
- Trimethylsilanol phosphite
- Tris(trimethylsily)phosphite
- Tris(trimethylsilyloxy)phosphine
- Tris(trimethylsilyl) phosphite
- See more synonyms
