CAS 17951-19-8

Justicidin B

Description:

Justicidin B is a naturally occurring chemical compound classified as a flavonoid, specifically a type of chalcone. It is derived from various plant sources, particularly those belonging to the genus Justicia. This compound is known for its potential biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. Justicidin B exhibits a unique structure characterized by a phenolic backbone, which contributes to its reactivity and interaction with biological systems. Its solubility can vary depending on the solvent used, and it is typically studied in the context of its pharmacological effects and potential therapeutic applications. Research into Justicidin B has highlighted its role in traditional medicine, as well as its potential in modern pharmacology, particularly in the development of new drugs targeting various diseases. As with many natural products, the extraction and purification processes are crucial for obtaining Justicidin B in a form suitable for research and application.

Formula: C₂₁H₁₆O₆

InChI: InChI=1S/C21H16O6/c1-23-16-7-12-5-13-9-25-21(22)20(13)19(14(12)8-17(16)24-2)11-3-4-15-18(6-11)27-10-26-15/h3-8H,9-10H2,1-2H3

InChI key: InChIKey=RTDRYYULUYRTAN-UHFFFAOYSA-N

SMILES: O=C1C2=C(C=3C(C=C2CO1)=CC(OC)=C(OC)C3)C=4C=C5C(=CC4)OCO5

Synonyms:

• Naphtho[2,3-c]furan-1(3H)-one, 6,7-dimethoxy-9-[3,4-(methylenedioxy)phenyl]-
• Naphtho[2,3-c]furan-1(3H)-one, 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-
• Justicidin B
• 9-(1,3-Benzodioxol-5-yl)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one

Justicidin B

CAS: 17951-19-8

Formula: C₂₁H₁₆O₆

Purity: 95%~99%

Molecular weight: 364.353

Ref: BP-BP4817

Justicidin B

CAS: 17951-19-8

Justicidin B: anticancer, proapoptotic, inhibits bone resorption & platelets, antiviral, fungicidal, antiprotozoal.

Formula: C₂₁H₁₆O₆

Color and Shape: Solid

Molecular weight: 364.35

Ref: TM-T72916