CAS 17952-87-3
:2,3,4,9-tetrahydro-6-methoxy-1H-pyrido[3,4-b]indol-1-one
Description:
2,3,4,9-Tetrahydro-6-methoxy-1H-pyrido[3,4-b]indol-1-one, with the CAS number 17952-87-3, is a chemical compound that belongs to the class of indole derivatives. This substance features a fused bicyclic structure that incorporates both pyridine and indole moieties, contributing to its unique chemical properties. It is characterized by the presence of a methoxy group, which can influence its solubility and reactivity. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the tetrahydro configuration indicates that it may participate in various chemical reactions, including those involving nucleophilic substitutions or electrophilic additions. Additionally, its specific stereochemistry can affect its interaction with biological targets, potentially leading to varied pharmacological effects. Overall, this compound's unique structural features and potential biological implications make it a subject of interest in chemical research.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c1-16-7-2-3-10-9(6-7)8-4-5-13-12(15)11(8)14-10/h2-3,6,14H,4-5H2,1H3,(H,13,15)
InChI key:InChIKey=PWARHDUWOJUADN-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C3=C(NC2=CC1)C(=O)NCC3
Synonyms:- 1H-Pyrido[3,4-b]indol-1-one, 2,3,4,9-tetrahydro-6-methoxy-
- 6-Methoxytetrahydro-1-norharmanone
- 6-methoxy-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one
- 2,3,4,9-Tetrahydro-6-methoxy-1H-pyrido(3,4-b)indol-1-one
- 2,3,4,9-Tetrahydro-6-methoxy-1H-pyrido[3,4-b]indol-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1H-Pyrido[3,4-b]indol-1-one, 2,3,4,9-tetrahydro-6-methoxy-
CAS:Formula:C12H12N2O2Purity:97%Color and Shape:SolidMolecular weight:216.23596-Methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-one
CAS:6-Methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-onePurity:98%Molecular weight:216.24g/mol6-methoxy-2,3,4,9-tetrahydro-1H-β-carbolin-1-one
CAS:Formula:C12H12N2O2Purity:≥97%Molecular weight:216.246-Methoxy-2,3,4,9-tetrahydro-1H-Β-carbolin-1-one
CAS:Controlled ProductApplications 6-methoxy-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one (cas# 17952-87-3) is a useful research chemical.
Formula:C12H12N2O2Color and Shape:NeatMolecular weight:216.2366-Methoxy-2,3,4,9-tetrahydro-1H-β-carbolin-1-one
CAS:6-Methoxy-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one is a β-carboline alkaloid that is structurally related to harmaline and tetrahydroharmine. It has been shown to have antidepressant activity in animals. 6-Methoxy-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one was analyzed by GC/MS and found to be present in the leaves of plants from the genus Tetraclinis. 6MHBC was also identified as a metabolite of diazepam in rat urine after administration of a single oral dose of 10 mg/kg diazepam. The observed β carboline metabolite was determined to be 6MHBC.Formula:C12H12N2O2Purity:Min. 95%Molecular weight:216.24 g/mol






