CAS 17954-98-2: 22(R)-hydroxycholesterol

Description:22(R)-hydroxycholesterol is a sterol compound that plays a significant role in various biological processes, particularly in the regulation of cholesterol metabolism and signaling pathways. It is an oxysterol, which means it is a derivative of cholesterol that has undergone oxidation. This compound is characterized by the presence of a hydroxyl group at the 22nd carbon position, which distinguishes it from other cholesterol derivatives. 22(R)-hydroxycholesterol is known to act as a ligand for liver X receptors (LXRs), influencing gene expression related to lipid metabolism and inflammation. Additionally, it can modulate the synthesis of steroid hormones and bile acids. The compound is typically found in various tissues and is involved in cellular signaling mechanisms. Its CAS number, 17954-98-2, is a unique identifier that facilitates the identification and study of this specific chemical substance in scientific literature and databases. Overall, 22(R)-hydroxycholesterol is an important molecule in the context of cholesterol homeostasis and cellular function.

Formula:C₂₇H₄₆O₂

InChI:InChI=1S/C27H46O2/c1-17(2)6-11-25(29)18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28-29H,6,8-16H2,1-5H3/t18-,20-,21-,22+,23-,24-,25+,26-,27+/m0/s1

InChI key:InChIKey=RZPAXNJLEKLXNO-GFKLAVDKSA-N

SMILES:OC1CC2=CCC3C(CCC4(C)C(CCC34)C(C)C(O)CCC(C)C)C2(C)CC1

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Cholest-5-ene-3,22-diol, (3β,22R)- REF: IN-DA002734CAS: 17954-98-2	99%	To inquire	Mon 07 Apr 25
22(R)-Hydroxycholesterol REF: 7W-GK8616CAS: 17954-98-2	- - -	To inquire	Tue 08 Apr 25
22-α-Hydroxy Cholesterol REF: 4Z-C-5314CAS: 17954-98-2	- - -	To inquire	Tue 08 Apr 25
22α-Hydroxy Cholesterol REF: TR-H918015CAS: 17954-98-2	- - -	256.00 €~1,707.00 €	Tue 15 Apr 25
22α-Hydroxy cholesterol REF: 3D-FH23942CAS: 17954-98-2	Min. 95%	373.00 €~2,381.00 €	Mon 19 May 25