CAS 17955-67-8
:1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane
Description:
1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilinane is a silane compound characterized by the presence of three silicon atoms, each bonded to ethoxy groups. This compound features a unique structure where the silicon atoms are interconnected, contributing to its potential applications in materials science, particularly in the development of siloxane-based polymers and coatings. The ethoxy groups enhance the solubility and reactivity of the silane, making it suitable for various chemical reactions, including cross-linking and surface modification. Its properties may include low volatility and stability under ambient conditions, which are advantageous for applications in adhesives, sealants, and as a coupling agent in composite materials. Additionally, the presence of multiple ethoxy groups can influence the hydrophobicity and adhesion properties of the resulting materials. As with many silanes, handling should be done with care due to potential reactivity with moisture, leading to the formation of silanol groups. Overall, 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane is a versatile compound with significant implications in advanced material applications.
Formula:C15H36O6Si3
InChI:InChI=1/C15H36O6Si3/c1-7-16-22(17-8-2)13-23(18-9-3,19-10-4)15-24(14-22,20-11-5)21-12-6/h7-15H2,1-6H3
SMILES:CCO[Si]1(C[Si](C[Si](C1)(OCC)OCC)(OCC)OCC)OCC
Synonyms:- 1,3,5-Trisilacyclohexane, 1,1,3,3,5,5-Hexaethoxy-
- 1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilinane
- 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilacyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3,5-Trisilacyclohexane, 1,1,3,3,5,5-hexaethoxy-
CAS:Formula:C15H36O6Si3Purity:90%Color and Shape:LiquidMolecular weight:396.69921,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane
CAS:1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexanePurity:95%Molecular weight:396.7g/mol1,1,3,3,5,5-HEXAETHOXY-1,3,5-TRISILACYCLOHEXANE
CAS:Formula:C15H36O6Si3Purity:97%Color and Shape:Straw LiquidMolecular weight:396.71,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane
CAS:Formula:C15H36O6Si3Purity:>90.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:396.701,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane
CAS:<p>S25176 - 1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane</p>Formula:C15H36O6Si3Purity:95%Color and Shape:ClearMolecular weight:396.7021,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane
CAS:<p>Please enquire for more information about 1,1,3,3,5,5-Hexaethoxy-1,3,5-trisilacyclohexane including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C15H36O6Si3Purity:90%NmrMolecular weight:396.7 g/mol





