
CAS 179555-05-6
:5-Ethynyl-4-methyl-2-pyridinamine
Description:
5-Ethynyl-4-methyl-2-pyridinamine, with the CAS number 179555-05-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethynyl group (-C≡CH) and a methyl group (-CH₃) attached to the pyridine ring, specifically at the 5 and 4 positions, respectively. The presence of the ethynyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including coupling reactions in organic synthesis. The amino group (-NH₂) at the 2-position enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Overall, 5-Ethynyl-4-methyl-2-pyridinamine is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C8H8N2
InChI:InChI=1S/C8H8N2/c1-3-7-5-10-8(9)4-6(7)2/h1,4-5H,2H3,(H2,9,10)
InChI key:InChIKey=CMJOZKYNXSVRGC-UHFFFAOYSA-N
SMILES:C(#C)C=1C(C)=CC(N)=NC1
Synonyms:- 2-Amino-5-ethynyl-4-methylpyridine
- 5-Ethynyl-4-methyl-2-pyridinamine
- 2-Pyridinamine, 5-ethynyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.