CAS 17956-40-0
:Sodium dipicolinate
Description:
Sodium dipicolinate is a chemical compound with the formula C10H8N2NaO4, commonly recognized for its role as a chelating agent and its applications in various fields, including biochemistry and agriculture. It is the sodium salt of dipicolinic acid, which is known for its ability to form stable complexes with metal ions, particularly calcium and magnesium. This property makes sodium dipicolinate useful in enhancing the bioavailability of these essential nutrients in agricultural formulations. The compound is typically a white to off-white powder, soluble in water, and exhibits a relatively stable nature under standard conditions. In biological systems, sodium dipicolinate is significant in the context of bacterial spores, where it contributes to the stability and resistance of spores to environmental stresses. Additionally, it has been studied for its potential applications in drug delivery and as a component in various analytical techniques. Overall, sodium dipicolinate is valued for its chelating properties and versatility in both scientific research and practical applications.
Formula:C7H5NO4·2Na
InChI:InChI=1S/C7H5NO4.2Na/c9-6(10)4-2-1-3-5(8-4)7(11)12;;/h1-3H,(H,9,10)(H,11,12);;
InChI key:InChIKey=DOFJBYVZXZTKSQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(C(O)=O)C=CC1.[Na]
Synonyms:- Disodium dipicolinate
- 2,6-Pyridinedicarboxylic acid, sodium salt (1:2)
- Disodium pyridine-2,6-dicarboxylate
- Sodium dipicolinate
- 2,6-Pyridinedicarboxylic acid, disodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
