CAS 17959-06-7
:4-amino-2,3,6-trimethylphenol
Description:
4-Amino-2,3,6-trimethylphenol, with the CAS number 17959-06-7, is an organic compound characterized by its aromatic structure, which includes an amino group and multiple methyl substituents on a phenolic ring. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including dye manufacturing, as an antioxidant, and in the synthesis of other chemical compounds. The presence of the amino group contributes to its reactivity, allowing it to participate in various chemical reactions, such as electrophilic substitution. Additionally, the methyl groups enhance its hydrophobic properties, influencing its solubility in organic solvents. The compound's stability and reactivity can be affected by environmental factors, such as pH and temperature. Safety data indicates that, like many amines and phenolic compounds, it should be handled with care due to potential health hazards, including skin and respiratory irritation. Overall, 4-amino-2,3,6-trimethylphenol is a versatile compound with significant industrial relevance.
Formula:C9H13NO
InChI:InChI=1/C9H13NO/c1-5-4-8(10)6(2)7(3)9(5)11/h4,11H,10H2,1-3H3
SMILES:Cc1cc(c(C)c(C)c1O)N
Synonyms:- Phenol, 4-Amino-2,3,6-Trimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Amino-2,3,6-trimethylphenol
CAS:4-Amino-2,3,6-trimethylphenol (4ATMP) is a halogenated phenol that has been used as a developer in the production of silver halide photographic emulsions. It interacts with hydrogen chloride to form a gaseous product and can be used as an indicator for the presence of chlorine gas. 4ATMP is also known to react with formaldehyde and acetaldehyde to produce formic acid and acetic acid respectively. 4ATMP is most commonly prepared by reacting phenol with diethylaminopropyl chloride in the presence of hydrogen chloride gas.
Formula:C9H13NOPurity:Min. 95%Molecular weight:151.21 g/molRef: 3D-SAA95906
Discontinued product
