CAS 179603-47-5
:2,4,6-trihydroxy-5-{(1S)-1-[(4S)-4-hydroxy-6-(2-hydroxypropan-2-yl)-4,8a-dimethyldecahydronaphthalen-1-yl]-3-methylbutyl}benzene-1,3-dicarbaldehyde
Description:
2,4,6-Trihydroxy-5-{(1S)-1-[(4S)-4-hydroxy-6-(2-hydroxypropan-2-yl)-4,8a-dimethyldecahydronaphthalen-1-yl]-3-methylbutyl}benzene-1,3-dicarbaldehyde, with CAS number 179603-47-5, is a complex organic compound characterized by multiple functional groups, including hydroxyl (-OH) and aldehyde (-CHO) groups. This structure suggests it may exhibit significant reactivity, particularly in forming hydrogen bonds and participating in various chemical reactions such as oxidation and condensation. The presence of multiple chiral centers indicates that the compound can exist in different stereoisomeric forms, which may influence its biological activity and interactions. The compound's hydrophilic hydroxyl groups may enhance its solubility in polar solvents, while the hydrophobic regions could affect its behavior in biological systems. Overall, this compound's intricate structure and functional diversity suggest potential applications in fields such as pharmaceuticals, where it may serve as a precursor or active ingredient in drug development. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C28H42O7
InChI:InChI=1/C28H42O7/c1-15(2)11-17(22-24(32)18(13-29)23(31)19(14-30)25(22)33)20-8-10-28(6,35)21-12-16(26(3,4)34)7-9-27(20,21)5/h13-17,20-21,31-35H,7-12H2,1-6H3/t16?,17-,20?,21?,27?,28-/m0/s1
SMILES:CC(C)C[C@@H](C1CC[C@@](C)(C2CC(CCC12C)C(C)(C)O)O)c1c(c(C=O)c(c(C=O)c1O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Benzenedicarboxaldehyde, 5-[(1S)-1-[(1S,4R,4aR,6R,8aS)-decahydro-4-hydroxy-6-(1-hydroxy-1-methylethyl)-4,8a-dimethyl-1-naphthalenyl]-3-methylbutyl]-2,4,6-trihydroxy-
CAS:Formula:C28H42O7Molecular weight:490.6289Macrocarpal J
CAS:Macrocarpal J has anti-bacterial activity, it also has anti-glucosyltransferase activity.Formula:C28H42O7Purity:98%Color and Shape:SolidMolecular weight:490.637Macrocarpal J
CAS:Formula:C28H42O7Purity:95%~99%Color and Shape:Yellow powderMolecular weight:490.637Macrocarpal J
CAS:<p>Macrocarpal J is a phenolic compound, specifically an acylphloroglucinol, which is derived from Eucalyptus species. Its origin lies within the leaves of certain Eucalyptus plants, where it is synthesized as part of the plant's natural defense mechanisms. Macrocarpal J exhibits notable biological activity through its antimicrobial and anti-inflammatory properties. Its mode of action involves disrupting microbial cell wall integrity and inhibiting pathways essential for microbial growth, thus contributing to its antibacterial and antifungal effects.</p>Formula:C28H42O7Purity:Min. 95%Molecular weight:490.6 g/mol



