CAS 179617-08-4

5-Bromo-1,3-difluoro-2-methylbenzene

Description:

5-Bromo-1,3-difluoro-2-methylbenzene, also known by its CAS number 179617-08-4, is an aromatic compound characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, along with a methyl group. This compound features a substituted benzene structure, which contributes to its chemical reactivity and physical properties. The bromine and fluorine substituents enhance its electronegativity and can influence its behavior in chemical reactions, making it a potential candidate for various applications in organic synthesis and materials science. Typically, such halogenated aromatic compounds exhibit distinct characteristics such as increased stability, altered boiling and melting points compared to their non-halogenated counterparts, and unique solubility profiles. Additionally, the presence of multiple halogens can affect the compound's reactivity, making it useful in the synthesis of pharmaceuticals, agrochemicals, and other functional materials. Safety considerations should be taken into account due to the potential toxicity of halogenated compounds.

Formula: C₇H₅BrF₂

InChI: InChI=1/C7H5BrF2/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3

SMILES: Cc1c(cc(cc1F)Br)F

Synonyms:

• Benzene, 5-bromo-1,3-difluoro-2-methyl-
• 5-BROMO-1,3-DIFLUORO-2-METHYLBENZENE
• 2,6-Difluoro-4-bromotoluene
• 4-BROMO-2,6-DIFLUOROTOLUENE

Benzene, 5-bromo-1,3-difluoro-2-methyl-

CAS: 179617-08-4

Formula: C₇H₅BrF₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 207.0154

Ref: IN-DA00274W

4-Bromo-2,6-difluorotoluene

CAS: 179617-08-4

4-Bromo-2,6-difluorotoluene

Purity: 95%

Molecular weight: 207.02g/mol

Ref: 54-PC10434

4-Bromo-2,6-difluorotoluene

CAS: 179617-08-4

Formula: C₇H₅BrF₂

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 207.018

Ref: 10-F043179