CAS 17965-80-9: 1,5-Naphthyridin-2-amine
Description:1,5-Naphthyridin-2-amine is a heterocyclic organic compound characterized by a fused bicyclic structure containing a nitrogen atom in the naphthyridine ring system. It features an amino group (-NH2) at the 2-position of the 1,5-naphthyridine framework, which contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on its specific structure and substituents. 1,5-Naphthyridin-2-amine is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as a scaffold for drug development targeting various biological pathways. Its nitrogen-containing heterocyclic structure can influence its interaction with biological targets, making it a subject of study in the development of new therapeutic agents. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c9-8-4-3-6-7(11-8)2-1-5-10-6/h1-5H,(H2,9,11)
InChI key:InChIKey=WVXADFXJVONWJY-UHFFFAOYSA-N
SMILES:N=1C=CC=C2N=C(N)C=CC12
- Synonyms:
- 1,5-Naphthyridin-2-amine
- 1,5-Naphthyridine, 2-amino-
- 2-Amino-1,5-naphthyridine
- 1,5-Naphthyridin-2-Ylamine
- [1,5]naphthyridin-2-ylamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,5-Naphthyridin-2-amine REF: IN-DA00276OCAS: 17965-80-9 | 98% | To inquire | Wed 16 Apr 25 |
![]() | 1,5-Naphthyridin-2-amine REF: 10-F791569CAS: 17965-80-9 | 98% | To inquire | Mon 28 Apr 25 |
![]() | 1,5-Naphthyridin-2-ylamine REF: 3D-SAA96580CAS: 17965-80-9 | Min. 95% | To inquire | Wed 28 May 25 |

1,5-Naphthyridin-2-amine
Ref: IN-DA00276O
1g | 508.00 € | ||
100mg | 192.00 € | ||
250mg | 217.00 € |

Ref: 10-F791569
1g | To inquire | ||
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

1,5-Naphthyridin-2-ylamine
Ref: 3D-SAA96580
1g | 792.00 € | ||
100mg | 376.00 € |