CAS 17965-81-0
:1,6-NAPHTHYRIDIN-2-AMINE
Description:
1,6-Naphthyridin-2-amine is a heterocyclic organic compound characterized by a naphthyridine ring structure, which consists of a fused bicyclic system containing nitrogen atoms. Specifically, it features a nitrogen atom at the 1 and 6 positions of the naphthyridine ring and an amino group (-NH2) at the 2 position. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on its specific structure and substituents. It is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The presence of the amino group can facilitate interactions with biological targets, making it a candidate for drug development. Additionally, 1,6-naphthyridin-2-amine may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, which can be leveraged in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H7N3
InChI:InChI=1/C8H7N3/c9-8-2-1-6-5-10-4-3-7(6)11-8/h1-5H,(H2,9,11)
SMILES:c1cc(=N)[nH]c2ccncc12
Synonyms:- [1,6]Naphthyridin-2-Ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,6-Naphthyridin-2-amine
CAS:A 1,6-Naphthyridin-2-amine is a chemical compound that can be synthesized in various yields by extracting it from coal tar. It has been used in the past to make n-substituted derivatives for use in combinatorial and screening studies. A 1,6-Naphthyridin-2-amine can be synthesized using a microwave irradiation technique that uses malononitrile as its starting material. The microwave irradiation technique is operational at low temperatures and can be tracked with a radiotracer. Microwave irradiation of malononitrile produces an intermediate that reacts with ammonia to produce the desired 1,6-naphthyridinone product. This product can then be converted into the desired 1,6-naphthyridin-2 amine via hydrogenation or nitration.
Formula:C8H7N3Purity:Min. 95%Molecular weight:145.16 g/mol



