CAS 17966-13-1
:(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid
Description:
(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid, with CAS number 17966-13-1, is a chemical compound characterized by its unique structure that includes an undecenoic acid backbone and an epoxide functional group. The presence of the (Z) configuration indicates that the double bond between the 9th and 10th carbon atoms is in the cis orientation, which can influence its reactivity and physical properties. The epoxide group, derived from the pentyloxirane moiety, contributes to the compound's potential for undergoing ring-opening reactions, making it reactive under certain conditions. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its solubility, melting point, and boiling point would depend on the specific interactions of its functional groups and the overall molecular weight. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of reactive functional groups. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H32O3
InChI:InChI=1/C18H32O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,16-17H,2-7,9-10,12-15H2,1H3,(H,19,20)/b11-8-/t16-,17+/m0/s1
Synonyms:- (9Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
cis-12,13-Epoxy-9(Z)-octadecenoic acid
CAS:Formula:C18H32O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:296.45(±)-cis-12,13-Epoxy-9(Z)-octadecenoic Acid
CAS:Controlled ProductApplications (±)-cis-12,13-Epoxy-9(Z)-octadecenoic Acid, an isomer of (-)-Vernolic Acid (V128710). a fatty acid that is monounsaturated and contains an epoxide. It is It is the cis epoxide derived from the C12–C13 alkene of linoleic acid, and an isomer of coronaric acid. Vernolic acid is the key component in vernonia oil, which is produced in abundance by the genera Vernonia and Euphorbia and is a potentially useful biofeedstock.
References Gunstone FD., ournal of the Chemical Society. 1954: 1611–1616(1954);Formula:C18H32O3Color and Shape:NeatMolecular weight:296.44

