CAS 179688-53-0
:3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate
Description:
3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This specific compound features a methoxy group at the 7-position and an acetate group, contributing to its overall reactivity and potential biological activity. The presence of the 4-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. The compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its structural features may suggest potential pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure may allow for interactions with biological targets, which could be explored for therapeutic applications. As with many quinazoline derivatives, it may also exhibit a range of biological activities, including anti-inflammatory or anticancer properties, although specific studies would be necessary to confirm such effects.
Formula:C11H10N2O4
InChI:InChI=1/C11H10N2O4/c1-6(14)17-10-3-7-8(4-9(10)16-2)12-5-13-11(7)15/h3-5H,1-2H3,(H,12,13,15)
SMILES:CC(=O)Oc1cc2c(cc1OC)ncnc2O
Synonyms:- 3,4-Dihydro-4-oxo-6-acetoxy-7-methoxyquinazoline
- 6-(Acetyloxy)-7-methoxy-4(3H)-quinazolinone
- 7-Methoxy-4-Oxo-3,4-Dihydroquinazolin-6-Yl Acetate
- 6-Acetoxy-7-methoxy-4(3H)-quinazolinone
- 6-acetoxy-7-methoxy-3,4-dihydroquinazolin-4(3H)-one
- (7-methoxy-4-oxo-1H-quinazolin-6-yl) acetate
- 6-Acetoxy-7-Methoxy-3,4-Dihydroquizolin-4-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
7-Methoxy-4-oxo-3,4-dihydroquinazolin-6-yl acetate
CAS:Formula:C11H10N2O4Purity:97%Color and Shape:SolidMolecular weight:234.20817-Methoxy-4-oxo-3,4-dihydroquinazolin-6-yl acetate
CAS:7-Methoxy-4-oxo-3,4-dihydroquinazolin-6-yl acetatePurity:98%Molecular weight:234.21g/mol6-Acetoxy-7-methoxy-3H-quinazolin-4-one
CAS:Formula:C11H10N2O4Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:234.217-methoxy-4-oxo-3,4-dihydroquinazolin-6-yl acetate
CAS:Purity:97%Color and Shape:SolidMolecular weight:234.2117-Methoxy-4-oxo-1,4-dihydroquinazolin-6-yl acetate
CAS:Formula:C11H10N2O4Purity:97%Color and Shape:SolidMolecular weight:234.2114-Hydroxy-7-methoxyquinazolin-6-yl Ester Acetic Acid
CAS:Controlled ProductApplications 4-Hydroxy-7-methoxyquinazolin-6-yl Ester Acetic Acid exhibit potent inhibitory activity against VEGFR-2/HDAC and a human breast cancer cell line MCF-7.
References Peng, F., et al.: Eur. J. Med. Chem., 109, 1-12 (2016)Formula:C11H10N2O4Color and Shape:NeatMolecular weight:234.21







