CymitQuimica logo

CAS 17969-22-1

:

4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole

Description:
4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) and a para-substituted chlorophenyl group, indicating the presence of chlorine atoms that can influence its reactivity and biological activity. The thiazole moiety is known for its role in various biological applications, including antimicrobial and antifungal properties. The presence of chlorine substituents can enhance lipophilicity and affect the compound's interaction with biological targets. Additionally, this compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary based on the presence of functional groups and environmental factors. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole is of interest in medicinal chemistry and material science for its unique structural features and potential applications.
Formula:C10H7Cl2NS
InChI:InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2
InChI key:UEJQTBKTWJQBRN-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1nc(CCl)cs1)Cl
Found 4 products.