CAS 17969-48-1

2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile

Description:

2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile, with the CAS number 17969-48-1, is a chemical compound characterized by its thiazole and acetonitrile functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its biological activity and potential pharmacological properties. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The acetonitrile moiety suggests that it may exhibit polar characteristics, which can affect its solubility and reactivity. Additionally, the compound may possess specific spectral properties that can be analyzed using techniques such as NMR or IR spectroscopy. Overall, 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile is of interest in various fields, including organic synthesis and drug discovery, due to its unique structural features and potential biological activities.

Formula: C₁₁H₇ClN₂S

InChI: InChI=1/C11H7ClN2S/c12-9-3-1-8(2-4-9)10-7-15-11(14-10)5-6-13/h1-4,7H,5H2

SMILES: c1cc(ccc1c1csc(CC#N)n1)Cl

Synonyms:

• 2-[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]acetonitrile
• [4-(4-Fluorophenyl)-1,3-Thiazol-2-Yl]Acetonitrile
• [4-(4-Chlorophenyl)-1,3-Thiazol-2-Yl]Acetonitrile

2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile

CAS: 17969-48-1

Formula: C₁₁H₇ClN₂S

Molecular weight: 234.7047

Ref: IN-DA00277F