CymitQuimica logo

CAS 17973-86-3

:

Pyridazine, 3,6-dibromo-

Description:
Pyridazine, 3,6-dibromo- is a heterocyclic organic compound characterized by a six-membered ring containing two nitrogen atoms at positions 1 and 2, with bromine substituents at positions 3 and 6. This compound is part of the pyridazine family, which is known for its aromatic properties and potential applications in pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity and may influence its biological activity, making it of interest in various chemical syntheses and research applications. Pyridazine derivatives often exhibit diverse properties, including antimicrobial and anti-inflammatory activities. The compound is typically a solid at room temperature and may have moderate solubility in organic solvents. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3,6-dibromopyridazine serves as a valuable building block in organic synthesis and materials science.
Formula:C4H2Br2N2
InChI:InChI=1/C4H2Br2N2/c5-3-1-2-4(6)8-7-3/h1-2H
InChI key:VQAFMTSSCUETHA-UHFFFAOYSA-N
SMILES:c1cc(Br)nnc1Br
Synonyms:
  • 3,6-Dibromopyridazine
  • 3,6-Dibromopyridazide
Found 8 products.