CAS 1798-82-9

4-CYCLOPROPYL-BENZOIC ACID

Description:

4-Cyclopropylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a cyclopropyl group attached to the para position of a benzoic acid structure. Its molecular formula is C10H10O2, indicating it contains ten carbon atoms, ten hydrogen atoms, and two oxygen atoms. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. The cyclopropyl group contributes to its unique chemical reactivity and steric properties, which can influence its behavior in various chemical reactions. 4-Cyclopropylbenzoic acid is of interest in organic synthesis and medicinal chemistry, where it may serve as a building block for more complex molecules or as a potential pharmaceutical agent. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. As with many organic acids, it can participate in acid-base reactions and may exhibit varying degrees of acidity depending on the solvent and conditions.

Formula: C₁₀H₁₀O₂

InChI: InChI=1/C10H10O2/c11-10(12)9-5-3-8(4-6-9)7-1-2-7/h3-7H,1-2H2,(H,11,12)

SMILES: C1CC1c1ccc(cc1)C(=O)O

Synonyms:

• Akos Bar-1173

Benzoic acid, 4-cyclopropyl-

CAS: 1798-82-9

Formula: C₁₀H₁₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.1852

Ref: IN-DA0027A0

4-Cyclopropyl-benzoic acid

CAS: 1798-82-9

4-Cyclopropyl-benzoic acid

Formula: C₁₀H₁₀O₂

Purity: ≥95%

Color and Shape: off-white solid

Molecular weight: 162.19g/mol

Ref: 54-OR451110

4-Cyclopropyl-benzoic acid

CAS: 1798-82-9

Formula: C₁₀H₁₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.188

Ref: 10-F029145