CAS 17980-16-4

2,6-dimethylphenanthrene

Description:

2,6-Dimethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of three fused benzene rings. This compound features two methyl groups attached to the phenanthrene backbone at the 2 and 6 positions, influencing its physical and chemical properties. It is typically a solid at room temperature and exhibits a high melting point, indicative of strong intermolecular interactions. 2,6-Dimethylphenanthrene is relatively hydrophobic, showing low solubility in water but higher solubility in organic solvents. It is known for its stability and resistance to degradation, which can lead to environmental persistence. The compound is of interest in various fields, including organic chemistry and environmental science, due to its potential role as a pollutant and its relevance in studies of combustion processes. Additionally, it may be involved in the formation of complex mixtures found in fossil fuels and can be a subject of research regarding its biological effects and potential carcinogenicity.

Formula: C₁₆H₁₄

InChI: InChI=1/C16H14/c1-11-4-8-15-14(9-11)7-6-13-5-3-12(2)10-16(13)15/h3-10H,1-2H3

SMILES: Cc1ccc2c(ccc3ccc(C)cc23)c1

Synonyms:

• Phenanthrene, 2,6-dimethyl

2,6-Dimethylphenanthrene

CAS: 17980-16-4

Formula: C₁₆H₁₄

Molecular weight: 206.29

Ref: 4Z-P-11304

2,6-Dimethylphenanthrene

Controlled Product

CAS: 17980-16-4

Applications 2,6-Dimethylphenanthrene have been used in investigating Polycyclic Aromatic Hydrocarbons Profiles in Higher Plants Using Statistical Models.
References Sojinu O., et al.: Int. J. Phytoremediat., 15, 439-451 (2013)

Formula: C₁₆H₁₄

Color and Shape: Neat

Molecular weight: 206.282

Ref: TR-D477280

Phenanthrene, 2,6-dimethyl-

CAS: 17980-16-4

Formula: C₁₆H₁₄

Molecular weight: 206.2824

Ref: IN-DA00279V