CAS 179811-74-6

β-Amino[1,1′-biphenyl]-4-ethanol

Description:

β-Amino[1,1′-biphenyl]-4-ethanol, identified by its CAS number 179811-74-6, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and influencing its chemical reactivity. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the hydroxyl group (-OH) enhances its solubility in polar solvents and can participate in hydrogen bonding interactions. The presence of these functional groups suggests that β-Amino[1,1′-biphenyl]-4-ethanol may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, its structural characteristics may allow for various synthetic modifications, potentially leading to derivatives with tailored properties. Overall, this compound's unique structure and functional groups position it as a versatile candidate for further research and application in various chemical and pharmaceutical contexts.

Formula: C₁₄H₁₅NO

InChI: InChI=1S/C14H15NO/c15-14(10-16)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,16H,10,15H2

InChI key: InChIKey=DRGRSSFCCDTWRF-UHFFFAOYSA-N

SMILES: C(CO)(N)C1=CC=C(C=C1)C2=CC=CC=C2

Synonyms:

• β-Amino[1,1′-biphenyl]-4-ethanol
• 2-Amino-2-(4-phenylphenyl)ethan-1-ol
• [1,1′-Biphenyl]-4-ethanol, β-amino-

2-Amino-2-(4-phenylphenyl)ethan-1-ol

CAS: 179811-74-6

Versatile small molecule scaffold

Formula: C₁₄H₁₅NO

Purity: Min. 95%

Molecular weight: 213.27 g/mol

Ref: 3D-EHA81174