CAS 17983-30-1
:Cyclohexanecarbonitrile, 3-oxo-
Description:
Cyclohexanecarbonitrile, 3-oxo- is an organic compound characterized by the presence of a cyclohexane ring, a nitrile functional group, and a ketone group. Its structure features a six-membered carbon ring with a cyano group (-C≡N) and a carbonyl group (C=O) attached to the same carbon atom, making it a member of the nitrile and ketone functional groups. This compound is typically colorless to pale yellow and may have a distinct odor. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic cyclohexane structure. Cyclohexanecarbonitrile, 3-oxo- is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity is influenced by the presence of the nitrile and carbonyl groups, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H9NO
InChI:InChI=1S/C7H9NO/c8-5-6-2-1-3-7(9)4-6/h6H,1-4H2
InChI key:PVUOBVLYQILCTE-UHFFFAOYSA-N
SMILES:C1CC(CC(=O)C1)C#N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Oxocyclohexane-1-carbonitrile
CAS:3-Oxocyclohexane-1-carbonitrileFormula:C7H9NOPurity:98%Molecular weight:123.153-Oxocyclohexanecarbonitrile
CAS:Formula:C7H9NOPurity:98%Color and Shape:LiquidMolecular weight:123.15253-Oxocyclohexanecarbonitrile
CAS:3-OxocyclohexanecarbonitrileFormula:C7H9NOPurity:95%Molecular weight:123.153-Oxocyclohexanecarbonitrile
CAS:Formula:C7H9NOPurity:98%Color and Shape:SolidMolecular weight:123.1553-Oxocyclohexanecarbonitrile
CAS:3-Oxocyclohexanecarbonitrile (3OHC) is a novel chemical compound with analgesic properties. 3OHC has been shown to be effective in reducing the inflammation of the human body. The mechanism of action has not yet been elucidated, but it may be due to its ability to inhibit prostaglandin synthesis and reduce the oxidative stress by forming reactive oxygen species. 3OHC is also an active antinociceptive agent that can be used in combination with other drugs to treat inflammatory diseases. 3OHC is able to reduce the pain caused by inflammatory diseases by reducing the production of prostaglandins, which are a group of chemicals that are responsible for causing pain and inflammation.Formula:C7H9NOPurity:Min. 95%Molecular weight:123.15 g/mol




