CAS 17985-72-7: 1,2-Bis(dimethylsilyl)benzene

Description:1,2-Bis(dimethylsilyl)benzene, with the CAS number 17985-72-7, is an organosilicon compound characterized by the presence of two dimethylsilyl groups attached to a benzene ring at the 1 and 2 positions. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low volatility and high thermal stability, making it suitable for various applications in materials science and organic synthesis. The dimethylsilyl groups contribute to its unique properties, such as increased hydrophobicity and enhanced chemical stability compared to unsubstituted benzene derivatives. Additionally, the presence of silicon in the structure can influence the compound's reactivity, allowing it to participate in various chemical reactions, including cross-coupling and polymerization processes. Its applications may extend to the development of silicone-based materials, coatings, and as a precursor in the synthesis of more complex organosilicon compounds. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula:C₁₀H₁₈Si₂

InChI:InChI=1/C10H18Si2/c1-11(2)9-7-5-6-8-10(9)12(3)4/h5-8,11-12H,1-4H3

Synonyms:
1,2-Phenylenebis(dimethylsilane)
1-(2-Bromoethyl)-4-Methylbenzene
Benzene-1,2-Diylbis(Dimethylsilane)

Found 6 products.

Product data	Purity	Price range	Estimated delivery
1,2-Bis(dimethylsilyl)benzene REF: 3B-B1699CAS: 17985-72-7	>94.0%(GC)	64.00 €~196.00 €	Mon 07 Apr 25
1,2-Bis(dimethylsilyl)benzene, 98% REF: 02-043755CAS: 17985-72-7	98%	To inquire	Tue 08 Apr 25
Benzene, 1,2-bis(dimethylsilyl)- REF: IN-DA0027BLCAS: 17985-72-7	97%	28.00 €~186.00 €	Mon 14 Apr 25
1,2-Bis(Dimethylsilyl)Benzene REF: 54-OR1029353CAS: 17985-72-7	98%	32.00 €~3,378.00 €	Tue 15 Apr 25
1,2-Bis(dimethylsilyl)benzene REF: 10-S01774CAS: 17985-72-7	95%	14.00 €~724.00 €	Thu 17 Apr 25
1,2-Bis(dimethylsilyl)benzene REF: 3D-FB40008CAS: 17985-72-7	Min. 95%	- - -	Discontinued product